C24H30ClN3O3S — CID 155243499
[(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)ethenoxy]methyl ethylsulfanylformate (PubChem CID 155243499) has the molecular formula C24H30ClN3O3S and a molecular weight of 476.04 g/mol. Its IUPAC name is [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)ethenoxy]methyl ethylsulfanylformate.
| Compound Name | [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)ethenoxy]methyl ethylsulfanylformate |
|---|---|
| PubChem CID | 155243499 |
| Molecular Formula | C24H30ClN3O3S |
| Molecular Weight | 476.04 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)ethenoxy]methyl ethylsulfanylformate |
| SMILES | CCSC(=O)OCO/C(=C(\c1ccc(C(C)(C)C)cc1)C1C=N1)c1c(Cl)c(C)nn1CC |
| InChI | InChI=1S/C24H30ClN3O3S/c1-7-28-21(20(25)15(3)27-28)22(30-14-31-23(29)32-8-2)19(18-13-26-18)16-9-11-17(12-10-16)24(4,5)6/h9-13,18H,7-8,14H2,1-6H3/b22-19+ |
| InChIKey | PRIGSXZMVWJDFK-ZBJSNUHESA-N |
| XLogP | 6.35 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.04 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|