C24H31N3O3 — CID 155243213
[(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,5-dimethylpyrazol-3-yl)ethenoxy]methyl butanoate (PubChem CID 155243213) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,5-dimethylpyrazol-3-yl)ethenoxy]methyl butanoate.
| Compound Name | [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,5-dimethylpyrazol-3-yl)ethenoxy]methyl butanoate |
|---|---|
| PubChem CID | 155243213 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,5-dimethylpyrazol-3-yl)ethenoxy]methyl butanoate |
| SMILES | CCCC(=O)OCO/C(=C(\c1ccc(C(C)(C)C)cc1)C1C=N1)c1cc(C)nn1C |
| InChI | InChI=1S/C24H31N3O3/c1-7-8-21(28)29-15-30-23(20-13-16(2)26-27(20)6)22(19-14-25-19)17-9-11-18(12-10-17)24(3,4)5/h9-14,19H,7-8,15H2,1-6H3/b23-22+ |
| InChIKey | VVNKSZRNWCKCPJ-GHVJWSGMSA-N |
| XLogP | 4.66 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|