C24H30ClN3O4 — CID 155243303
1-[(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,5-dimethylpyrazol-3-yl)ethenoxy]ethyl 2-chloroethyl carbonate (PubChem CID 155243303) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is 1-[(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,5-dimethylpyrazol-3-yl)ethenoxy]ethyl 2-chloroethyl carbonate.
| Compound Name | 1-[(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,5-dimethylpyrazol-3-yl)ethenoxy]ethyl 2-chloroethyl carbonate |
|---|---|
| PubChem CID | 155243303 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 1-[(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,5-dimethylpyrazol-3-yl)ethenoxy]ethyl 2-chloroethyl carbonate |
| SMILES | Cc1cc(/C(OC(C)OC(=O)OCCCl)=C(/c2ccc(C(C)(C)C)cc2)C2C=N2)n(C)n1 |
| InChI | InChI=1S/C24H30ClN3O4/c1-15-13-20(28(6)27-15)22(31-16(2)32-23(29)30-12-11-25)21(19-14-26-19)17-7-9-18(10-8-17)24(3,4)5/h7-10,13-14,16,19H,11-12H2,1-6H3/b22-21+ |
| InChIKey | JVVYARQQFXJDHR-QURGRASLSA-N |
| XLogP | 5.10 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|