C26H35N3O4 — CID 155243141
[(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,5-dimethylpyrazol-3-yl)ethenoxy]methyl 2-methylbutyl carbonate (PubChem CID 155243141) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,5-dimethylpyrazol-3-yl)ethenoxy]methyl 2-methylbutyl carbonate.
| Compound Name | [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,5-dimethylpyrazol-3-yl)ethenoxy]methyl 2-methylbutyl carbonate |
|---|---|
| PubChem CID | 155243141 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,5-dimethylpyrazol-3-yl)ethenoxy]methyl 2-methylbutyl carbonate |
| SMILES | CCC(C)COC(=O)OCO/C(=C(\c1ccc(C(C)(C)C)cc1)C1C=N1)c1cc(C)nn1C |
| InChI | InChI=1S/C26H35N3O4/c1-8-17(2)15-31-25(30)33-16-32-24(22-13-18(3)28-29(22)7)23(21-14-27-21)19-9-11-20(12-10-19)26(4,5)6/h9-14,17,21H,8,15-16H2,1-7H3/b24-23+ |
| InChIKey | GDERFEUUCCMBAR-WCWDXBQESA-N |
| XLogP | 5.52 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|