C26H34ClN3O4 — CID 155243716
[(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)ethenoxy]methyl 2-methylpropyl carbonate (PubChem CID 155243716) has the molecular formula C26H34ClN3O4 and a molecular weight of 488.03 g/mol. Its IUPAC name is [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)ethenoxy]methyl 2-methylpropyl carbonate.
| Compound Name | [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)ethenoxy]methyl 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 155243716 |
| Molecular Formula | C26H34ClN3O4 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)ethenoxy]methyl 2-methylpropyl carbonate |
| SMILES | CCn1nc(C)c(Cl)c1/C(OCOC(=O)OCC(C)C)=C(/c1ccc(C(C)(C)C)cc1)C1C=N1 |
| InChI | InChI=1S/C26H34ClN3O4/c1-8-30-23(22(27)17(4)29-30)24(33-15-34-25(31)32-14-16(2)3)21(20-13-28-20)18-9-11-19(12-10-18)26(5,6)7/h9-13,16,20H,8,14-15H2,1-7H3/b24-21+ |
| InChIKey | AHWPZPDRYORHDS-DARPEHSRSA-N |
| XLogP | 6.27 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|