C27H39N3O4 — CID 155243383
[(E)-2-(4-tert-butylphenyl)-1-(2-ethyl-4,5-dimethylpyrazol-3-yl)-3-iminoprop-1-enoxy]methyl 3-methylbutyl carbonate (PubChem CID 155243383) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is [(E)-2-(4-tert-butylphenyl)-1-(2-ethyl-4,5-dimethylpyrazol-3-yl)-3-iminoprop-1-enoxy]methyl 3-methylbutyl carbonate.
| Compound Name | [(E)-2-(4-tert-butylphenyl)-1-(2-ethyl-4,5-dimethylpyrazol-3-yl)-3-iminoprop-1-enoxy]methyl 3-methylbutyl carbonate |
|---|---|
| PubChem CID | 155243383 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | [(E)-2-(4-tert-butylphenyl)-1-(2-ethyl-4,5-dimethylpyrazol-3-yl)-3-iminoprop-1-enoxy]methyl 3-methylbutyl carbonate |
| SMILES | [H]/N=C/C(=C(/OCOC(=O)OCCC(C)C)c1c(C)c(C)nn1CC)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H39N3O4/c1-9-30-24(19(4)20(5)29-30)25(33-17-34-26(31)32-15-14-18(2)3)23(16-28)21-10-12-22(13-11-21)27(6,7)8/h10-13,16,18,28H,9,14-15,17H2,1-8H3/b25-23-,28-16+ |
| InChIKey | SNDVPBJNECSBQQ-XLFVIZOISA-N |
| XLogP | 6.51 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|