C33H47N3O4 — CID 163532750
1-[(E)-2-(4-tert-butylphenyl)-1-[4-(1-cyclopropylcyclobutyl)-1,3-dimethylpyrazol-5-yl]-3-iminoprop-1-enoxy]ethyl 3-methylbutyl carbonate (PubChem CID 163532750) has the molecular formula C33H47N3O4 and a molecular weight of 549.76 g/mol. Its IUPAC name is 1-[(E)-2-(4-tert-butylphenyl)-1-[4-(1-cyclopropylcyclobutyl)-1,3-dimethylpyrazol-5-yl]-3-iminoprop-1-enoxy]ethyl 3-methylbutyl carbonate.
| Compound Name | 1-[(E)-2-(4-tert-butylphenyl)-1-[4-(1-cyclopropylcyclobutyl)-1,3-dimethylpyrazol-5-yl]-3-iminoprop-1-enoxy]ethyl 3-methylbutyl carbonate |
|---|---|
| PubChem CID | 163532750 |
| Molecular Formula | C33H47N3O4 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | 1-[(E)-2-(4-tert-butylphenyl)-1-[4-(1-cyclopropylcyclobutyl)-1,3-dimethylpyrazol-5-yl]-3-iminoprop-1-enoxy]ethyl 3-methylbutyl carbonate |
| SMILES | [H]/N=C/C(=C(/OC(C)OC(=O)OCCC(C)C)c1c(C2(C3CC3)CCC2)c(C)nn1C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H47N3O4/c1-21(2)16-19-38-31(37)40-23(4)39-30(27(20-34)24-10-12-25(13-11-24)32(5,6)7)29-28(22(3)35-36(29)8)33(17-9-18-33)26-14-15-26/h10-13,20-21,23,26,34H,9,14-19H2,1-8H3/b30-27-,34-20+ |
| InChIKey | DUJVRAQEQOTTQW-AMYKJHSNSA-N |
| XLogP | 7.94 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|