C24H31Cl2N3O4 — CID 155243697
[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]methyl 2-chloroethyl carbonate (PubChem CID 155243697) has the molecular formula C24H31Cl2N3O4 and a molecular weight of 496.44 g/mol. Its IUPAC name is [(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]methyl 2-chloroethyl carbonate.
| Compound Name | [(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]methyl 2-chloroethyl carbonate |
|---|---|
| PubChem CID | 155243697 |
| Molecular Formula | C24H31Cl2N3O4 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | [(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]methyl 2-chloroethyl carbonate |
| SMILES | CCn1nc(C)c(Cl)c1/C(OCOC(=O)OCCCl)=C(\C=N\C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H31Cl2N3O4/c1-7-29-21(20(26)16(2)28-29)22(32-15-33-23(30)31-13-12-25)19(14-27-6)17-8-10-18(11-9-17)24(3,4)5/h8-11,14H,7,12-13,15H2,1-6H3/b22-19-,27-14+ |
| InChIKey | VBBIQVGBWUVHLB-CMSVCFAKSA-N |
| XLogP | 6.10 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|