C22H27ClFN3O3 — CID 155243516
[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1,3-dimethylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]methyl 2-fluoroacetate (PubChem CID 155243516) has the molecular formula C22H27ClFN3O3 and a molecular weight of 435.93 g/mol. Its IUPAC name is [(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1,3-dimethylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]methyl 2-fluoroacetate.
| Compound Name | [(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1,3-dimethylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]methyl 2-fluoroacetate |
|---|---|
| PubChem CID | 155243516 |
| Molecular Formula | C22H27ClFN3O3 |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1,3-dimethylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]methyl 2-fluoroacetate |
| SMILES | C/N=C/C(=C(/OCOC(=O)CF)c1c(Cl)c(C)nn1C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H27ClFN3O3/c1-14-19(23)20(27(6)26-14)21(30-13-29-18(28)11-24)17(12-25-5)15-7-9-16(10-8-15)22(2,3)4/h7-10,12H,11,13H2,1-6H3/b21-17-,25-12+ |
| InChIKey | NPVDGZYCYFVGAL-VJGJPUOHSA-N |
| XLogP | 4.74 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|