C25H34ClN3O4 — CID 155243255
1-[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]ethyl 2-methoxyacetate (PubChem CID 155243255) has the molecular formula C25H34ClN3O4 and a molecular weight of 476.02 g/mol. Its IUPAC name is 1-[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]ethyl 2-methoxyacetate.
| Compound Name | 1-[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]ethyl 2-methoxyacetate |
|---|---|
| PubChem CID | 155243255 |
| Molecular Formula | C25H34ClN3O4 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 1-[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]ethyl 2-methoxyacetate |
| SMILES | CCn1nc(C)c(Cl)c1/C(OC(C)OC(=O)COC)=C(\C=N\C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H34ClN3O4/c1-9-29-23(22(26)16(2)28-29)24(33-17(3)32-21(30)15-31-8)20(14-27-7)18-10-12-19(13-11-18)25(4,5)6/h10-14,17H,9,15H2,1-8H3/b24-20-,27-14+ |
| InChIKey | ZMEWGEUSLMLBGH-FTDWLFOTSA-N |
| XLogP | 5.28 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|