C27H37N3O4 — CID 155243161
[(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,4,5-trimethylpyrazol-3-yl)ethenoxy]methyl pentyl carbonate (PubChem CID 155243161) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,4,5-trimethylpyrazol-3-yl)ethenoxy]methyl pentyl carbonate.
| Compound Name | [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,4,5-trimethylpyrazol-3-yl)ethenoxy]methyl pentyl carbonate |
|---|---|
| PubChem CID | 155243161 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | [(E)-2-(2H-azirin-2-yl)-2-(4-tert-butylphenyl)-1-(2,4,5-trimethylpyrazol-3-yl)ethenoxy]methyl pentyl carbonate |
| SMILES | CCCCCOC(=O)OCO/C(=C(\c1ccc(C(C)(C)C)cc1)C1C=N1)c1c(C)c(C)nn1C |
| InChI | InChI=1S/C27H37N3O4/c1-8-9-10-15-32-26(31)34-17-33-25(24-18(2)19(3)29-30(24)7)23(22-16-28-22)20-11-13-21(14-12-20)27(4,5)6/h11-14,16,22H,8-10,15,17H2,1-7H3/b25-23+ |
| InChIKey | KBKNGYVNHAMIGD-WJTDDFOZSA-N |
| XLogP | 5.97 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|