C11H10ClN5OS — CID 9499272
(4S)-4-[(3-chlorophenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carbothioamide (PubChem CID 9499272) has the molecular formula C11H10ClN5OS and a molecular weight of 295.76 g/mol. Its IUPAC name is (4S)-4-[(3-chlorophenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carbothioamide.
| Compound Name | (4S)-4-[(3-chlorophenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carbothioamide |
|---|---|
| PubChem CID | 9499272 |
| Molecular Formula | C11H10ClN5OS |
| Molecular Weight | 295.76 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | (4S)-4-[(3-chlorophenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carbothioamide |
| SMILES | CC1=NN(C(N)=S)C(=O)[C@H]1/N=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H10ClN5OS/c1-6-9(10(18)17(16-6)11(13)19)15-14-8-4-2-3-7(12)5-8/h2-5,9H,1H3,(H2,13,19)/b15-14+/t9-/m0/s1 |
| InChIKey | HRWZBMNGPMIXNH-SOLLPLKKSA-N |
| XLogP | 2.25 |
| TPSA | 83.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.76 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|