C12H13N5OS — CID 98119078
(4R)-3-methyl-4-[(2-methylphenyl)diazenyl]-5-oxo-4H-pyrazole-1-carbothioamide (PubChem CID 98119078) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is (4R)-3-methyl-4-[(2-methylphenyl)diazenyl]-5-oxo-4H-pyrazole-1-carbothioamide.
| Compound Name | (4R)-3-methyl-4-[(2-methylphenyl)diazenyl]-5-oxo-4H-pyrazole-1-carbothioamide |
|---|---|
| PubChem CID | 98119078 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (4R)-3-methyl-4-[(2-methylphenyl)diazenyl]-5-oxo-4H-pyrazole-1-carbothioamide |
| SMILES | CC1=NN(C(N)=S)C(=O)[C@@H]1/N=N/c1ccccc1C |
| InChI | InChI=1S/C12H13N5OS/c1-7-5-3-4-6-9(7)14-15-10-8(2)16-17(11(10)18)12(13)19/h3-6,10H,1-2H3,(H2,13,19)/b15-14+/t10-/m1/s1 |
| InChIKey | KZDYVCZKNAMYNP-KDGRRTAISA-N |
| XLogP | 1.91 |
| TPSA | 83.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|