C15H14N6O3S — CID 102253854
4-[(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide (PubChem CID 102253854) has the molecular formula C15H14N6O3S and a molecular weight of 358.38 g/mol. Its IUPAC name is 4-[(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide.
| Compound Name | 4-[(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 102253854 |
| Molecular Formula | C15H14N6O3S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-[(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide |
| SMILES | CC1=NNC(=O)C1/N=N/c1ccc(S(=O)(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C15H14N6O3S/c1-10-14(15(22)20-17-10)19-18-11-5-7-12(8-6-11)25(23,24)21-13-4-2-3-9-16-13/h2-9,14H,1H3,(H,16,21)(H,20,22)/b19-18+ |
| InChIKey | NBVCYDHXPAJJND-VHEBQXMUSA-N |
| XLogP | 1.84 |
| TPSA | 125.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|