C20H14Br3N5OS — CID 124542586
(4R)-5-methyl-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-4-[(2,4,6-tribromophenyl)diazenyl]-4H-pyrazol-3-one (PubChem CID 124542586) has the molecular formula C20H14Br3N5OS and a molecular weight of 612.15 g/mol. Its IUPAC name is (4R)-5-methyl-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-4-[(2,4,6-tribromophenyl)diazenyl]-4H-pyrazol-3-one.
| Compound Name | (4R)-5-methyl-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-4-[(2,4,6-tribromophenyl)diazenyl]-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 124542586 |
| Molecular Formula | C20H14Br3N5OS |
| Molecular Weight | 612.15 g/mol |
| Exact Mass | 608.85 |
| IUPAC Name | (4R)-5-methyl-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-4-[(2,4,6-tribromophenyl)diazenyl]-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2nc(-c3ccc(C)cc3)cs2)C(=O)[C@@H]1/N=N/c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C20H14Br3N5OS/c1-10-3-5-12(6-4-10)16-9-30-20(24-16)28-19(29)17(11(2)27-28)25-26-18-14(22)7-13(21)8-15(18)23/h3-9,17H,1-2H3/b26-25+/t17-/m1/s1 |
| InChIKey | INSMPLWGZSWHHP-OZMIJRPQSA-N |
| XLogP | 7.28 |
| TPSA | 70.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.15 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|