C19H20N2O4 — CID 118869707
6-methoxy-3-(3-phenylmethoxypropyl)-1H-quinazoline-2,4-dione (PubChem CID 118869707) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 6-methoxy-3-(3-phenylmethoxypropyl)-1H-quinazoline-2,4-dione.
| Compound Name | 6-methoxy-3-(3-phenylmethoxypropyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 118869707 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 6-methoxy-3-(3-phenylmethoxypropyl)-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc2[nH]c(=O)n(CCCOCc3ccccc3)c(=O)c2c1 |
| InChI | InChI=1S/C19H20N2O4/c1-24-15-8-9-17-16(12-15)18(22)21(19(23)20-17)10-5-11-25-13-14-6-3-2-4-7-14/h2-4,6-9,12H,5,10-11,13H2,1H3,(H,20,23) |
| InChIKey | ADRXUFAADDDZKZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|