C19H12N4O5 — CID 137065643
6-hydroxy-5-(indol-2-ylidenemethyl)-1-(4-nitrophenyl)pyrimidine-2,4-dione (PubChem CID 137065643) has the molecular formula C19H12N4O5 and a molecular weight of 376.33 g/mol. Its IUPAC name is 6-hydroxy-5-(indol-2-ylidenemethyl)-1-(4-nitrophenyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-(indol-2-ylidenemethyl)-1-(4-nitrophenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137065643 |
| Molecular Formula | C19H12N4O5 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 6-hydroxy-5-(indol-2-ylidenemethyl)-1-(4-nitrophenyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccc([N+](=O)[O-])cc2)c(O)c1C=C1C=c2ccccc2=N1 |
| InChI | InChI=1S/C19H12N4O5/c24-17-15(10-12-9-11-3-1-2-4-16(11)20-12)18(25)22(19(26)21-17)13-5-7-14(8-6-13)23(27)28/h1-10,25H,(H,21,24,26) |
| InChIKey | QNXNINLPZVLYBL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|