C15H12N4O3 — CID 22059877
5-cyclopropyl-4-[(E)-(5-nitroindol-2-ylidene)methyl]-1,2-dihydropyrazol-3-one (PubChem CID 22059877) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 5-cyclopropyl-4-[(E)-(5-nitroindol-2-ylidene)methyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-cyclopropyl-4-[(E)-(5-nitroindol-2-ylidene)methyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 22059877 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-cyclopropyl-4-[(E)-(5-nitroindol-2-ylidene)methyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1[nH][nH]c(C2CC2)c1/C=C1\C=c2cc([N+](=O)[O-])ccc2=N1 |
| InChI | InChI=1S/C15H12N4O3/c20-15-12(14(17-18-15)8-1-2-8)7-10-5-9-6-11(19(21)22)3-4-13(9)16-10/h3-8H,1-2H2,(H2,17,18,20)/b10-7+ |
| InChIKey | PTBQOAABQNTKPD-JXMROGBWSA-N |
| XLogP | 0.94 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|