C28H20N4O5S — CID 136623102
6-hydroxy-5-[[5-(2-methyl-4-nitrophenyl)pyrrol-2-ylidene]methyl]-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 136623102) has the molecular formula C28H20N4O5S and a molecular weight of 524.56 g/mol. Its IUPAC name is 6-hydroxy-5-[[5-(2-methyl-4-nitrophenyl)pyrrol-2-ylidene]methyl]-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 6-hydroxy-5-[[5-(2-methyl-4-nitrophenyl)pyrrol-2-ylidene]methyl]-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 136623102 |
| Molecular Formula | C28H20N4O5S |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 6-hydroxy-5-[[5-(2-methyl-4-nitrophenyl)pyrrol-2-ylidene]methyl]-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | Cc1cc([N+](=O)[O-])ccc1C1=NC(=Cc2c(O)n(-c3ccc(Oc4ccccc4)cc3)c(=S)[nH]c2=O)C=C1 |
| InChI | InChI=1S/C28H20N4O5S/c1-17-15-20(32(35)36)10-13-23(17)25-14-7-18(29-25)16-24-26(33)30-28(38)31(27(24)34)19-8-11-22(12-9-19)37-21-5-3-2-4-6-21/h2-16,34H,1H3,(H,30,33,38) |
| InChIKey | WZWWJNXHOYOERW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|