C29H28N2O3S — CID 91468087
6-hydroxy-5-[2-methyl-3-(4-propan-2-ylphenyl)prop-1-enyl]-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 91468087) has the molecular formula C29H28N2O3S and a molecular weight of 484.62 g/mol. Its IUPAC name is 6-hydroxy-5-[2-methyl-3-(4-propan-2-ylphenyl)prop-1-enyl]-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 6-hydroxy-5-[2-methyl-3-(4-propan-2-ylphenyl)prop-1-enyl]-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 91468087 |
| Molecular Formula | C29H28N2O3S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 6-hydroxy-5-[2-methyl-3-(4-propan-2-ylphenyl)prop-1-enyl]-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | CC(=Cc1c(O)n(-c2ccc(Oc3ccccc3)cc2)c(=S)[nH]c1=O)Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C29H28N2O3S/c1-19(2)22-11-9-21(10-12-22)17-20(3)18-26-27(32)30-29(35)31(28(26)33)23-13-15-25(16-14-23)34-24-7-5-4-6-8-24/h4-16,18-19,33H,17H2,1-3H3,(H,30,32,35) |
| InChIKey | GMNVMQRHDROUEL-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|