C21H16N4O3S — CID 136655184
6-hydroxy-5-[(5-methylimidazol-4-ylidene)methyl]-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 136655184) has the molecular formula C21H16N4O3S and a molecular weight of 404.45 g/mol. Its IUPAC name is 6-hydroxy-5-[(5-methylimidazol-4-ylidene)methyl]-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 6-hydroxy-5-[(5-methylimidazol-4-ylidene)methyl]-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 136655184 |
| Molecular Formula | C21H16N4O3S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 6-hydroxy-5-[(5-methylimidazol-4-ylidene)methyl]-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | CC1=NC=NC1=Cc1c(O)n(-c2ccc(Oc3ccccc3)cc2)c(=S)[nH]c1=O |
| InChI | InChI=1S/C21H16N4O3S/c1-13-18(23-12-22-13)11-17-19(26)24-21(29)25(20(17)27)14-7-9-16(10-8-14)28-15-5-3-2-4-6-15/h2-12,27H,1H3,(H,24,26,29) |
| InChIKey | HVGFCZIRPHMZLH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|