C30H27N3O5S — CID 90886825
benzyl 4-[[6-hydroxy-4-oxo-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-5-yl]methylidene]piperidine-1-carboxylate (PubChem CID 90886825) has the molecular formula C30H27N3O5S and a molecular weight of 541.63 g/mol. Its IUPAC name is benzyl 4-[[6-hydroxy-4-oxo-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-5-yl]methylidene]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[6-hydroxy-4-oxo-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-5-yl]methylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90886825 |
| Molecular Formula | C30H27N3O5S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | benzyl 4-[[6-hydroxy-4-oxo-1-(4-phenoxyphenyl)-2-sulfanylidenepyrimidin-5-yl]methylidene]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(=Cc2c(O)n(-c3ccc(Oc4ccccc4)cc3)c(=S)[nH]c2=O)CC1 |
| InChI | InChI=1S/C30H27N3O5S/c34-27-26(19-21-15-17-32(18-16-21)30(36)37-20-22-7-3-1-4-8-22)28(35)33(29(39)31-27)23-11-13-25(14-12-23)38-24-9-5-2-6-10-24/h1-14,19,35H,15-18,20H2,(H,31,34,39) |
| InChIKey | CSXYIEBLPFKQFG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|