C20H13FN4O4S — CID 135504602
1-(2-fluorophenyl)-6-hydroxy-5-[(E)-(2-methyl-5-nitroindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 135504602) has the molecular formula C20H13FN4O4S and a molecular weight of 424.41 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-6-hydroxy-5-[(E)-(2-methyl-5-nitroindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(2-fluorophenyl)-6-hydroxy-5-[(E)-(2-methyl-5-nitroindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135504602 |
| Molecular Formula | C20H13FN4O4S |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 1-(2-fluorophenyl)-6-hydroxy-5-[(E)-(2-methyl-5-nitroindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | CC1=Nc2ccc([N+](=O)[O-])cc2/C1=C\c1c(O)n(-c2ccccc2F)c(=S)[nH]c1=O |
| InChI | InChI=1S/C20H13FN4O4S/c1-10-12(13-8-11(25(28)29)6-7-16(13)22-10)9-14-18(26)23-20(30)24(19(14)27)17-5-3-2-4-15(17)21/h2-9,27H,1H3,(H,23,26,30)/b12-9- |
| InChIKey | YHBGMSWIOCCSKK-XFXZXTDPSA-N |
| XLogP | 4.29 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|