C14H13N3O5 — CID 2222899
methyl 4-[(6-hydroxy-1-methyl-2,4-dioxopyrimidin-5-yl)methylideneamino]benzoate (PubChem CID 2222899) has the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. Its IUPAC name is methyl 4-[(6-hydroxy-1-methyl-2,4-dioxopyrimidin-5-yl)methylideneamino]benzoate.
| Compound Name | methyl 4-[(6-hydroxy-1-methyl-2,4-dioxopyrimidin-5-yl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 2222899 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | methyl 4-[(6-hydroxy-1-methyl-2,4-dioxopyrimidin-5-yl)methylideneamino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C/c2c(O)n(C)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C14H13N3O5/c1-17-12(19)10(11(18)16-14(17)21)7-15-9-5-3-8(4-6-9)13(20)22-2/h3-7,19H,1-2H3,(H,16,18,21)/b15-7+ |
| InChIKey | LDURZCALMBTULT-VIZOYTHASA-N |
| XLogP | 0.32 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|