C17H20N4O4 — CID 137075354
N,N-diethyl-4-[(6-hydroxy-1-methyl-2,4-dioxopyrimidin-5-yl)methylideneamino]benzamide (PubChem CID 137075354) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is N,N-diethyl-4-[(6-hydroxy-1-methyl-2,4-dioxopyrimidin-5-yl)methylideneamino]benzamide.
| Compound Name | N,N-diethyl-4-[(6-hydroxy-1-methyl-2,4-dioxopyrimidin-5-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 137075354 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N,N-diethyl-4-[(6-hydroxy-1-methyl-2,4-dioxopyrimidin-5-yl)methylideneamino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(/N=C/c2c(O)n(C)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H20N4O4/c1-4-21(5-2)15(23)11-6-8-12(9-7-11)18-10-13-14(22)19-17(25)20(3)16(13)24/h6-10,24H,4-5H2,1-3H3,(H,19,22,25)/b18-10+ |
| InChIKey | LOPORNIGMNPASD-VCHYOVAHSA-N |
| XLogP | 1.01 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|