C12H8N3O5- — CID 2303609
4-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]benzoate (PubChem CID 2303609) has the molecular formula C12H8N3O5- and a molecular weight of 274.21 g/mol. Its IUPAC name is 4-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]benzoate.
| Compound Name | 4-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 2303609 |
| Molecular Formula | C12H8N3O5- |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]benzoate |
| SMILES | O=C([O-])c1ccc(/N=C/c2c(O)[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C12H9N3O5/c16-9-8(10(17)15-12(20)14-9)5-13-7-3-1-6(2-4-7)11(18)19/h1-5H,(H,18,19)(H3,14,15,16,17,20)/p-1/b13-5+ |
| InChIKey | VUFHEIJMZSQQIR-WLRTZDKTSA-M |
| XLogP | -1.12 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|