C16H16N4O3 — CID 165344050
4-nitro-2-[[(2S)-2-pyridin-3-ylpyrrolidin-1-yl]iminomethyl]phenol (PubChem CID 165344050) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 4-nitro-2-[[(2S)-2-pyridin-3-ylpyrrolidin-1-yl]iminomethyl]phenol.
| Compound Name | 4-nitro-2-[[(2S)-2-pyridin-3-ylpyrrolidin-1-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 165344050 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 4-nitro-2-[[(2S)-2-pyridin-3-ylpyrrolidin-1-yl]iminomethyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(C=NN2CCC[C@H]2c2cccnc2)c1 |
| InChI | InChI=1S/C16H16N4O3/c21-16-6-5-14(20(22)23)9-13(16)11-18-19-8-2-4-15(19)12-3-1-7-17-10-12/h1,3,5-7,9-11,15,21H,2,4,8H2/t15-/m0/s1 |
| InChIKey | JWEXWRAQBCEUPQ-HNNXBMFYSA-N |
| XLogP | 2.87 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|