C15H14BrN3O2 — CID 60699203
3-[1-(4-bromo-2-nitrophenyl)pyrrolidin-2-yl]pyridine (PubChem CID 60699203) has the molecular formula C15H14BrN3O2 and a molecular weight of 348.20 g/mol. Its IUPAC name is 3-[1-(4-bromo-2-nitrophenyl)pyrrolidin-2-yl]pyridine.
| Compound Name | 3-[1-(4-bromo-2-nitrophenyl)pyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 60699203 |
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 3-[1-(4-bromo-2-nitrophenyl)pyrrolidin-2-yl]pyridine |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1N1CCCC1c1cccnc1 |
| InChI | InChI=1S/C15H14BrN3O2/c16-12-5-6-14(15(9-12)19(20)21)18-8-2-4-13(18)11-3-1-7-17-10-11/h1,3,5-7,9-10,13H,2,4,8H2 |
| InChIKey | YXTRCJOUNBJTGY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|