C24H26N4O2S — CID 1390151
6-hydroxy-1,3-bis(2-methylphenyl)-5-(piperidin-1-yliminomethyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 1390151) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 6-hydroxy-1,3-bis(2-methylphenyl)-5-(piperidin-1-yliminomethyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 6-hydroxy-1,3-bis(2-methylphenyl)-5-(piperidin-1-yliminomethyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 1390151 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 6-hydroxy-1,3-bis(2-methylphenyl)-5-(piperidin-1-yliminomethyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | Cc1ccccc1-n1c(O)c(C=NN2CCCCC2)c(=O)n(-c2ccccc2C)c1=S |
| InChI | InChI=1S/C24H26N4O2S/c1-17-10-4-6-12-20(17)27-22(29)19(16-25-26-14-8-3-9-15-26)23(30)28(24(27)31)21-13-7-5-11-18(21)2/h4-7,10-13,16,29H,3,8-9,14-15H2,1-2H3 |
| InChIKey | HWAJLOKFBKWPRI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|