C20H19N5O4 — CID 135451611
N-[(E)-[6-hydroxy-2,4-dioxo-1-(4-propan-2-ylphenyl)pyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide (PubChem CID 135451611) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is N-[(E)-[6-hydroxy-2,4-dioxo-1-(4-propan-2-ylphenyl)pyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[6-hydroxy-2,4-dioxo-1-(4-propan-2-ylphenyl)pyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135451611 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[(E)-[6-hydroxy-2,4-dioxo-1-(4-propan-2-ylphenyl)pyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide |
| SMILES | CC(C)c1ccc(-n2c(O)c(/C=N/NC(=O)c3ccncc3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H19N5O4/c1-12(2)13-3-5-15(6-4-13)25-19(28)16(18(27)23-20(25)29)11-22-24-17(26)14-7-9-21-10-8-14/h3-12,28H,1-2H3,(H,24,26)(H,23,27,29)/b22-11+ |
| InChIKey | GBZMZXWFHRQKSA-SSDVNMTOSA-N |
| XLogP | 1.51 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|