C23H18ClN3O3S — CID 91033080
5-[(4-benzoyl-1-methylpyrrol-2-yl)methyl]-1-(4-chlorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 91033080) has the molecular formula C23H18ClN3O3S and a molecular weight of 451.94 g/mol. Its IUPAC name is 5-[(4-benzoyl-1-methylpyrrol-2-yl)methyl]-1-(4-chlorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(4-benzoyl-1-methylpyrrol-2-yl)methyl]-1-(4-chlorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 91033080 |
| Molecular Formula | C23H18ClN3O3S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 5-[(4-benzoyl-1-methylpyrrol-2-yl)methyl]-1-(4-chlorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | Cn1cc(C(=O)c2ccccc2)cc1Cc1c(O)n(-c2ccc(Cl)cc2)c(=S)[nH]c1=O |
| InChI | InChI=1S/C23H18ClN3O3S/c1-26-13-15(20(28)14-5-3-2-4-6-14)11-18(26)12-19-21(29)25-23(31)27(22(19)30)17-9-7-16(24)8-10-17/h2-11,13,30H,12H2,1H3,(H,25,29,31) |
| InChIKey | VXSQNQUZIYUFBD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|