C15H10ClIN2O3S — CID 91416930
1-(4-chlorophenyl)-6-hydroxy-5-[(5-iodofuran-2-yl)methyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 91416930) has the molecular formula C15H10ClIN2O3S and a molecular weight of 460.68 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-hydroxy-5-[(5-iodofuran-2-yl)methyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(4-chlorophenyl)-6-hydroxy-5-[(5-iodofuran-2-yl)methyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 91416930 |
| Molecular Formula | C15H10ClIN2O3S |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 459.91 |
| IUPAC Name | 1-(4-chlorophenyl)-6-hydroxy-5-[(5-iodofuran-2-yl)methyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2ccc(Cl)cc2)c(O)c1Cc1ccc(I)o1 |
| InChI | InChI=1S/C15H10ClIN2O3S/c16-8-1-3-9(4-2-8)19-14(21)11(13(20)18-15(19)23)7-10-5-6-12(17)22-10/h1-6,21H,7H2,(H,18,20,23) |
| InChIKey | ODHMTVVQZMFYQP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|