C10H7ClN2O2S — CID 885501
1-(4-chlorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 885501) has the molecular formula C10H7ClN2O2S and a molecular weight of 254.70 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(4-chlorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 885501 |
| Molecular Formula | C10H7ClN2O2S |
| Molecular Weight | 254.70 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 1-(4-chlorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1cc(O)n(-c2ccc(Cl)cc2)c(=S)[nH]1 |
| InChI | InChI=1S/C10H7ClN2O2S/c11-6-1-3-7(4-2-6)13-9(15)5-8(14)12-10(13)16/h1-5,15H,(H,12,14,16) |
| InChIKey | DACWOYFGOJZYJO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.70 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|