About 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one
6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one (PubChem CID 14303860) has the molecular formula C26H23NO3
and a molecular weight of 397.47 g/mol. Its IUPAC name is 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one.
Molecular Properties
| Compound Name | 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one |
| PubChem CID | 14303860 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one |
| SMILES | COc1ccc(OC)c(-c2cc(=O)c(C)c(-c3ccccc3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C26H23NO3/c1-18-24(28)17-23(22-16-21(29-2)14-15-25(22)30-3)27(20-12-8-5-9-13-20)26(18)19-10-6-4-7-11-19/h4-17H,1-3H3 |
| InChIKey | KQAADTRLAFWNSN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one?
The IUPAC name of 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one (CID 14303860) is 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one.
What is the SMILES notation for 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one?
The canonical SMILES for 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one is COc1ccc(OC)c(-c2cc(=O)c(C)c(-c3ccccc3)n2-c2ccccc2)c1.
What is the InChIKey of 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one?
The InChIKey is KQAADTRLAFWNSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23NO3/c1-18-24(28)17-23(22-16-21(29-2)14-15-25(22)30-3)27(20-12-8-5-9-13-20)26(18)19-10-6-4-7-11-19/h4-17H,1-3H3.
What are the key properties of 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one?
6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one has a molecular weight of 397.47 g/mol, XLogP of 5.50, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dimethoxyphenyl)-3-methyl-1,2-diphenylpyridin-4-one is sourced from PubChem (CID 14303860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).