C26H17Cl2N — CID 154721682
1-(2,4-dichlorophenyl)-2,3-diphenylindole (PubChem CID 154721682) has the molecular formula C26H17Cl2N and a molecular weight of 414.34 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2,3-diphenylindole.
| Compound Name | 1-(2,4-dichlorophenyl)-2,3-diphenylindole |
|---|---|
| PubChem CID | 154721682 |
| Molecular Formula | C26H17Cl2N |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2,3-diphenylindole |
| SMILES | Clc1ccc(-n2c(-c3ccccc3)c(-c3ccccc3)c3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C26H17Cl2N/c27-20-15-16-24(22(28)17-20)29-23-14-8-7-13-21(23)25(18-9-3-1-4-10-18)26(29)19-11-5-2-6-12-19/h1-17H |
| InChIKey | CFZJFPZIUOPBDK-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |