C25H28N2 — CID 10570277
cyclohexyl-[5-methyl-1-(4-methylphenyl)-2-phenylpyrrol-3-yl]methanimine (PubChem CID 10570277) has the molecular formula C25H28N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is cyclohexyl-[5-methyl-1-(4-methylphenyl)-2-phenylpyrrol-3-yl]methanimine.
| Compound Name | cyclohexyl-[5-methyl-1-(4-methylphenyl)-2-phenylpyrrol-3-yl]methanimine |
|---|---|
| PubChem CID | 10570277 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | cyclohexyl-[5-methyl-1-(4-methylphenyl)-2-phenylpyrrol-3-yl]methanimine |
| SMILES | [H]/N=C(/c1cc(C)n(-c2ccc(C)cc2)c1-c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C25H28N2/c1-18-13-15-22(16-14-18)27-19(2)17-23(24(26)20-9-5-3-6-10-20)25(27)21-11-7-4-8-12-21/h4,7-8,11-17,20,26H,3,5-6,9-10H2,1-2H3/b26-24+ |
| InChIKey | HACWLDWRPOLUNV-SHHOIMCASA-N |
| XLogP | 6.71 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|