C24H20N2O2S — CID 3472388
2-[1-(4-methylphenyl)-4,5-diphenylimidazol-2-yl]sulfanylacetic acid (PubChem CID 3472388) has the molecular formula C24H20N2O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[1-(4-methylphenyl)-4,5-diphenylimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(4-methylphenyl)-4,5-diphenylimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 3472388 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-[1-(4-methylphenyl)-4,5-diphenylimidazol-2-yl]sulfanylacetic acid |
| SMILES | Cc1ccc(-n2c(SCC(=O)O)nc(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N2O2S/c1-17-12-14-20(15-13-17)26-23(19-10-6-3-7-11-19)22(18-8-4-2-5-9-18)25-24(26)29-16-21(27)28/h2-15H,16H2,1H3,(H,27,28) |
| InChIKey | OTJOTZAVJDADGQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |