C29H30N2O4 — CID 139614640
2-[5-[1-(4-methylphenyl)-4,5-diphenylimidazol-2-yl]oxypentoxy]acetic acid (PubChem CID 139614640) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[5-[1-(4-methylphenyl)-4,5-diphenylimidazol-2-yl]oxypentoxy]acetic acid.
| Compound Name | 2-[5-[1-(4-methylphenyl)-4,5-diphenylimidazol-2-yl]oxypentoxy]acetic acid |
|---|---|
| PubChem CID | 139614640 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 2-[5-[1-(4-methylphenyl)-4,5-diphenylimidazol-2-yl]oxypentoxy]acetic acid |
| SMILES | Cc1ccc(-n2c(OCCCCCOCC(=O)O)nc(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30N2O4/c1-22-15-17-25(18-16-22)31-28(24-13-7-3-8-14-24)27(23-11-5-2-6-12-23)30-29(31)35-20-10-4-9-19-34-21-26(32)33/h2-3,5-8,11-18H,4,9-10,19-21H2,1H3,(H,32,33) |
| InChIKey | TVCXSUHNSBLHPR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|