C29H30N2NaO3+ — CID 18957381
sodium 8-(1,4,5-triphenylimidazol-2-yl)oxyoctanoic acid (PubChem CID 18957381) has the molecular formula C29H30N2NaO3+ and a molecular weight of 477.56 g/mol. Its IUPAC name is sodium 8-(1,4,5-triphenylimidazol-2-yl)oxyoctanoic acid.
| Compound Name | sodium 8-(1,4,5-triphenylimidazol-2-yl)oxyoctanoic acid |
|---|---|
| PubChem CID | 18957381 |
| Molecular Formula | C29H30N2NaO3+ |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | sodium 8-(1,4,5-triphenylimidazol-2-yl)oxyoctanoic acid |
| SMILES | O=C(O)CCCCCCCOc1nc(-c2ccccc2)c(-c2ccccc2)n1-c1ccccc1.[Na+] |
| InChI | InChI=1S/C29H30N2O3.Na/c32-26(33)21-13-2-1-3-14-22-34-29-30-27(23-15-7-4-8-16-23)28(24-17-9-5-10-18-24)31(29)25-19-11-6-12-20-25;/h4-12,15-20H,1-3,13-14,21-22H2,(H,32,33);/q;+1 |
| InChIKey | LNWHKJZRGPCQKH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|