C24H22N2O3 — CID 15296805
5-(2,3-diphenylbenzimidazol-5-yl)oxypentanoic acid (PubChem CID 15296805) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 5-(2,3-diphenylbenzimidazol-5-yl)oxypentanoic acid.
| Compound Name | 5-(2,3-diphenylbenzimidazol-5-yl)oxypentanoic acid |
|---|---|
| PubChem CID | 15296805 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 5-(2,3-diphenylbenzimidazol-5-yl)oxypentanoic acid |
| SMILES | O=C(O)CCCCOc1ccc2nc(-c3ccccc3)n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H22N2O3/c27-23(28)13-7-8-16-29-20-14-15-21-22(17-20)26(19-11-5-2-6-12-19)24(25-21)18-9-3-1-4-10-18/h1-6,9-12,14-15,17H,7-8,13,16H2,(H,27,28) |
| InChIKey | SONSQWMFWCVYMP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|