About N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide
N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide (PubChem CID 10184418) has the molecular formula C31H35N3O2
and a molecular weight of 481.64 g/mol. Its IUPAC name is N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide.
Molecular Properties
| Compound Name | N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide |
| PubChem CID | 10184418 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)nc3ccc(OCCCCCC(=O)NC4CCC4)cc32)cc1C |
| InChI | InChI=1S/C31H35N3O2/c1-22-15-16-26(20-23(22)2)34-29-21-27(17-18-28(29)33-31(34)24-10-5-3-6-11-24)36-19-8-4-7-14-30(35)32-25-12-9-13-25/h3,5-6,10-11,15-18,20-21,25H,4,7-9,12-14,19H2,1-2H3,(H,32,35) |
| InChIKey | VOTIVYSZBZSXEN-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide?
The IUPAC name of N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide (CID 10184418) is N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide.
What is the SMILES notation for N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide?
The canonical SMILES for N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide is Cc1ccc(-n2c(-c3ccccc3)nc3ccc(OCCCCCC(=O)NC4CCC4)cc32)cc1C.
What is the InChIKey of N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide?
The InChIKey is VOTIVYSZBZSXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H35N3O2/c1-22-15-16-26(20-23(22)2)34-29-21-27(17-18-28(29)33-31(34)24-10-5-3-6-11-24)36-19-8-4-7-14-30(35)32-25-12-9-13-25/h3,5-6,10-11,15-18,20-21,25H,4,7-9,12-14,19H2,1-2H3,(H,32,35).
What are the key properties of N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide?
N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide has a molecular weight of 481.64 g/mol, XLogP of 6.92, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutyl-6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanamide is sourced from PubChem (CID 10184418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).