C44H52N4O6 — CID 158789257
methyl 6-(3-methyl-2-phenylbenzimidazol-5-yl)oxyhexanoate;methyl 6-(2-phenyl-3-propylbenzimidazol-5-yl)oxyhexanoate (PubChem CID 158789257) has the molecular formula C44H52N4O6 and a molecular weight of 732.92 g/mol. Its IUPAC name is methyl 6-(3-methyl-2-phenylbenzimidazol-5-yl)oxyhexanoate;methyl 6-(2-phenyl-3-propylbenzimidazol-5-yl)oxyhexanoate.
| Compound Name | methyl 6-(3-methyl-2-phenylbenzimidazol-5-yl)oxyhexanoate;methyl 6-(2-phenyl-3-propylbenzimidazol-5-yl)oxyhexanoate |
|---|---|
| PubChem CID | 158789257 |
| Molecular Formula | C44H52N4O6 |
| Molecular Weight | 732.92 g/mol |
| Exact Mass | 732.39 |
| IUPAC Name | methyl 6-(3-methyl-2-phenylbenzimidazol-5-yl)oxyhexanoate;methyl 6-(2-phenyl-3-propylbenzimidazol-5-yl)oxyhexanoate |
| SMILES | CCCn1c(-c2ccccc2)nc2ccc(OCCCCCC(=O)OC)cc21.COC(=O)CCCCCOc1ccc2nc(-c3ccccc3)n(C)c2c1 |
| InChI | InChI=1S/C23H28N2O3.C21H24N2O3/c1-3-15-25-21-17-19(28-16-9-5-8-12-22(26)27-2)13-14-20(21)24-23(25)18-10-6-4-7-11-18;1-23-19-15-17(26-14-8-4-7-11-20(24)25-2)12-13-18(19)22-21(23)16-9-5-3-6-10-16/h4,6-7,10-11,13-14,17H,3,5,8-9,12,15-16H2,1-2H3;3,5-6,9-10,12-13,15H,4,7-8,11,14H2,1-2H3 |
| InChIKey | ISBIQICOYBOOBL-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 106.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.92 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|