C28H37N3O6 — CID 10142330
methyl 6-[3-[3-[(2-methoxyacetyl)-methylamino]propyl]-2-(4-methoxyphenyl)benzimidazol-5-yl]oxyhexanoate (PubChem CID 10142330) has the molecular formula C28H37N3O6 and a molecular weight of 511.62 g/mol. Its IUPAC name is methyl 6-[3-[3-[(2-methoxyacetyl)-methylamino]propyl]-2-(4-methoxyphenyl)benzimidazol-5-yl]oxyhexanoate.
| Compound Name | methyl 6-[3-[3-[(2-methoxyacetyl)-methylamino]propyl]-2-(4-methoxyphenyl)benzimidazol-5-yl]oxyhexanoate |
|---|---|
| PubChem CID | 10142330 |
| Molecular Formula | C28H37N3O6 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | methyl 6-[3-[3-[(2-methoxyacetyl)-methylamino]propyl]-2-(4-methoxyphenyl)benzimidazol-5-yl]oxyhexanoate |
| SMILES | COCC(=O)N(C)CCCn1c(-c2ccc(OC)cc2)nc2ccc(OCCCCCC(=O)OC)cc21 |
| InChI | InChI=1S/C28H37N3O6/c1-30(26(32)20-34-2)16-8-17-31-25-19-23(37-18-7-5-6-9-27(33)36-4)14-15-24(25)29-28(31)21-10-12-22(35-3)13-11-21/h10-15,19H,5-9,16-18,20H2,1-4H3 |
| InChIKey | PZUFVSVYRGHSRY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 92.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|