C22H28N2O4S — CID 10202025
methyl 6-[3-(3-methoxypropyl)-2-thiophen-2-ylbenzimidazol-5-yl]oxyhexanoate (PubChem CID 10202025) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is methyl 6-[3-(3-methoxypropyl)-2-thiophen-2-ylbenzimidazol-5-yl]oxyhexanoate.
| Compound Name | methyl 6-[3-(3-methoxypropyl)-2-thiophen-2-ylbenzimidazol-5-yl]oxyhexanoate |
|---|---|
| PubChem CID | 10202025 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | methyl 6-[3-(3-methoxypropyl)-2-thiophen-2-ylbenzimidazol-5-yl]oxyhexanoate |
| SMILES | COCCCn1c(-c2cccs2)nc2ccc(OCCCCCC(=O)OC)cc21 |
| InChI | InChI=1S/C22H28N2O4S/c1-26-13-7-12-24-19-16-17(28-14-5-3-4-9-21(25)27-2)10-11-18(19)23-22(24)20-8-6-15-29-20/h6,8,10-11,15-16H,3-5,7,9,12-14H2,1-2H3 |
| InChIKey | KWNGXBFAEJFQKK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|