C27H28N2O3 — CID 10296194
methyl 6-[3-(3-methylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate (PubChem CID 10296194) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is methyl 6-[3-(3-methylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate.
| Compound Name | methyl 6-[3-(3-methylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate |
|---|---|
| PubChem CID | 10296194 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | methyl 6-[3-(3-methylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate |
| SMILES | COC(=O)CCCCCOc1ccc2nc(-c3ccccc3)n(-c3cccc(C)c3)c2c1 |
| InChI | InChI=1S/C27H28N2O3/c1-20-10-9-13-22(18-20)29-25-19-23(32-17-8-4-7-14-26(30)31-2)15-16-24(25)28-27(29)21-11-5-3-6-12-21/h3,5-6,9-13,15-16,18-19H,4,7-8,14,17H2,1-2H3 |
| InChIKey | BDCORTVVZFGUPQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|