C33H32N2O4 — CID 67365250
methyl 6-[2-phenyl-3-(3-phenylmethoxyphenyl)benzimidazol-5-yl]oxyhexanoate (PubChem CID 67365250) has the molecular formula C33H32N2O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is methyl 6-[2-phenyl-3-(3-phenylmethoxyphenyl)benzimidazol-5-yl]oxyhexanoate.
| Compound Name | methyl 6-[2-phenyl-3-(3-phenylmethoxyphenyl)benzimidazol-5-yl]oxyhexanoate |
|---|---|
| PubChem CID | 67365250 |
| Molecular Formula | C33H32N2O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | methyl 6-[2-phenyl-3-(3-phenylmethoxyphenyl)benzimidazol-5-yl]oxyhexanoate |
| SMILES | COC(=O)CCCCCOc1ccc2nc(-c3ccccc3)n(-c3cccc(OCc4ccccc4)c3)c2c1 |
| InChI | InChI=1S/C33H32N2O4/c1-37-32(36)18-9-4-10-21-38-29-19-20-30-31(23-29)35(33(34-30)26-14-7-3-8-15-26)27-16-11-17-28(22-27)39-24-25-12-5-2-6-13-25/h2-3,5-8,11-17,19-20,22-23H,4,9-10,18,21,24H2,1H3 |
| InChIKey | JQACUOPVSLEQRV-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|