C26H26N2O5S — CID 22397874
6-[2-(benzenesulfonyl)-3-(4-methylphenyl)benzimidazol-5-yl]oxyhexanoic acid (PubChem CID 22397874) has the molecular formula C26H26N2O5S and a molecular weight of 478.57 g/mol. Its IUPAC name is 6-[2-(benzenesulfonyl)-3-(4-methylphenyl)benzimidazol-5-yl]oxyhexanoic acid.
| Compound Name | 6-[2-(benzenesulfonyl)-3-(4-methylphenyl)benzimidazol-5-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 22397874 |
| Molecular Formula | C26H26N2O5S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 6-[2-(benzenesulfonyl)-3-(4-methylphenyl)benzimidazol-5-yl]oxyhexanoic acid |
| SMILES | Cc1ccc(-n2c(S(=O)(=O)c3ccccc3)nc3ccc(OCCCCCC(=O)O)cc32)cc1 |
| InChI | InChI=1S/C26H26N2O5S/c1-19-11-13-20(14-12-19)28-24-18-21(33-17-7-3-6-10-25(29)30)15-16-23(24)27-26(28)34(31,32)22-8-4-2-5-9-22/h2,4-5,8-9,11-16,18H,3,6-7,10,17H2,1H3,(H,29,30) |
| InChIKey | CNILRDLONVVIBE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|