C24H28N2O3 — CID 139614614
8-[1-(4-methylphenyl)-5-phenylimidazol-2-yl]oxyoctanoic acid (PubChem CID 139614614) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 8-[1-(4-methylphenyl)-5-phenylimidazol-2-yl]oxyoctanoic acid.
| Compound Name | 8-[1-(4-methylphenyl)-5-phenylimidazol-2-yl]oxyoctanoic acid |
|---|---|
| PubChem CID | 139614614 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 8-[1-(4-methylphenyl)-5-phenylimidazol-2-yl]oxyoctanoic acid |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)cnc2OCCCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C24H28N2O3/c1-19-13-15-21(16-14-19)26-22(20-10-6-5-7-11-20)18-25-24(26)29-17-9-4-2-3-8-12-23(27)28/h5-7,10-11,13-16,18H,2-4,8-9,12,17H2,1H3,(H,27,28) |
| InChIKey | OUQJWPYXOJNPNT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|