C25H30N2O4 — CID 139614652
2-[6-[5-(3-methoxyphenyl)-1-(4-methylphenyl)imidazol-2-yl]hexoxy]acetic acid (PubChem CID 139614652) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[6-[5-(3-methoxyphenyl)-1-(4-methylphenyl)imidazol-2-yl]hexoxy]acetic acid.
| Compound Name | 2-[6-[5-(3-methoxyphenyl)-1-(4-methylphenyl)imidazol-2-yl]hexoxy]acetic acid |
|---|---|
| PubChem CID | 139614652 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-[6-[5-(3-methoxyphenyl)-1-(4-methylphenyl)imidazol-2-yl]hexoxy]acetic acid |
| SMILES | COc1cccc(-c2cnc(CCCCCCOCC(=O)O)n2-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C25H30N2O4/c1-19-11-13-21(14-12-19)27-23(20-8-7-9-22(16-20)30-2)17-26-24(27)10-5-3-4-6-15-31-18-25(28)29/h7-9,11-14,16-17H,3-6,10,15,18H2,1-2H3,(H,28,29) |
| InChIKey | INHXQAMKMJPMGH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|