C36H31NO5 — CID 71241990
4-[4-[3-[3-(hydroxymethyl)phenyl]-6-(3-methoxyphenyl)carbazol-9-yl]phenoxy]butanoic acid (PubChem CID 71241990) has the molecular formula C36H31NO5 and a molecular weight of 557.65 g/mol. Its IUPAC name is 4-[4-[3-[3-(hydroxymethyl)phenyl]-6-(3-methoxyphenyl)carbazol-9-yl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[3-[3-(hydroxymethyl)phenyl]-6-(3-methoxyphenyl)carbazol-9-yl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 71241990 |
| Molecular Formula | C36H31NO5 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 4-[4-[3-[3-(hydroxymethyl)phenyl]-6-(3-methoxyphenyl)carbazol-9-yl]phenoxy]butanoic acid |
| SMILES | COc1cccc(-c2ccc3c(c2)c2cc(-c4cccc(CO)c4)ccc2n3-c2ccc(OCCCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C36H31NO5/c1-41-31-8-3-7-26(20-31)28-11-17-35-33(22-28)32-21-27(25-6-2-5-24(19-25)23-38)10-16-34(32)37(35)29-12-14-30(15-13-29)42-18-4-9-36(39)40/h2-3,5-8,10-17,19-22,38H,4,9,18,23H2,1H3,(H,39,40) |
| InChIKey | WAAUPCRLXPNOTL-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|